C18H23N5OS2 — CID 54376798
1-(3-cyanophenyl)-3-(5-octylsulfanyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 54376798) has the molecular formula C18H23N5OS2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-(5-octylsulfanyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-(3-cyanophenyl)-3-(5-octylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 54376798 |
| Molecular Formula | C18H23N5OS2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 1-(3-cyanophenyl)-3-(5-octylsulfanyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCCCCCCSc1nnc(NC(=O)Nc2cccc(C#N)c2)s1 |
| InChI | InChI=1S/C18H23N5OS2/c1-2-3-4-5-6-7-11-25-18-23-22-17(26-18)21-16(24)20-15-10-8-9-14(12-15)13-19/h8-10,12H,2-7,11H2,1H3,(H2,20,21,22,24) |
| InChIKey | UXBSWGGUEPQVDE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|