C20H24N6O3S2 — CID 177246371
tert-butyl 4-[[5-[(4-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]piperidine-1-carboxylate (PubChem CID 177246371) has the molecular formula C20H24N6O3S2 and a molecular weight of 460.59 g/mol. Its IUPAC name is tert-butyl 4-[[5-[(4-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-[(4-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177246371 |
| Molecular Formula | C20H24N6O3S2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | tert-butyl 4-[[5-[(4-cyanophenyl)carbamoylamino]-1,3,4-thiadiazol-2-yl]sulfanyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Sc2nnc(NC(=O)Nc3ccc(C#N)cc3)s2)CC1 |
| InChI | InChI=1S/C20H24N6O3S2/c1-20(2,3)29-19(28)26-10-8-15(9-11-26)30-18-25-24-17(31-18)23-16(27)22-14-6-4-13(12-21)5-7-14/h4-7,15H,8-11H2,1-3H3,(H2,22,23,24,27) |
| InChIKey | BQCHVNPKNXWWGH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|