C19H19N5O3S — CID 156676812
1-[3-[2-(2-aminoethoxy)ethoxy]phenyl]-3-(6-isocyano-1,3-benzothiazol-2-yl)urea (PubChem CID 156676812) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 1-[3-[2-(2-aminoethoxy)ethoxy]phenyl]-3-(6-isocyano-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[3-[2-(2-aminoethoxy)ethoxy]phenyl]-3-(6-isocyano-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 156676812 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-[3-[2-(2-aminoethoxy)ethoxy]phenyl]-3-(6-isocyano-1,3-benzothiazol-2-yl)urea |
| SMILES | [C-]#[N+]c1ccc2nc(NC(=O)Nc3cccc(OCCOCCN)c3)sc2c1 |
| InChI | InChI=1S/C19H19N5O3S/c1-21-13-5-6-16-17(12-13)28-19(23-16)24-18(25)22-14-3-2-4-15(11-14)27-10-9-26-8-7-20/h2-6,11-12H,7-10,20H2,(H2,22,23,24,25) |
| InChIKey | JTXHZNJRYBOHOH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|