C19H18N4OS — CID 156676808
1-(4-tert-butylphenyl)-3-(6-isocyano-1,3-benzothiazol-2-yl)urea (PubChem CID 156676808) has the molecular formula C19H18N4OS and a molecular weight of 350.45 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(6-isocyano-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-(6-isocyano-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 156676808 |
| Molecular Formula | C19H18N4OS |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(6-isocyano-1,3-benzothiazol-2-yl)urea |
| SMILES | [C-]#[N+]c1ccc2nc(NC(=O)Nc3ccc(C(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C19H18N4OS/c1-19(2,3)12-5-7-13(8-6-12)21-17(24)23-18-22-15-10-9-14(20-4)11-16(15)25-18/h5-11H,1-3H3,(H2,21,22,23,24) |
| InChIKey | NQHIBKHFAOVZQC-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 58.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|