C20H19N5O4S — CID 156676831
2-(2-aminoethoxy)ethyl 3-[(6-isocyano-1,3-benzothiazol-2-yl)carbamoylamino]benzoate (PubChem CID 156676831) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 3-[(6-isocyano-1,3-benzothiazol-2-yl)carbamoylamino]benzoate.
| Compound Name | 2-(2-aminoethoxy)ethyl 3-[(6-isocyano-1,3-benzothiazol-2-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 156676831 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 3-[(6-isocyano-1,3-benzothiazol-2-yl)carbamoylamino]benzoate |
| SMILES | [C-]#[N+]c1ccc2nc(NC(=O)Nc3cccc(C(=O)OCCOCCN)c3)sc2c1 |
| InChI | InChI=1S/C20H19N5O4S/c1-22-14-5-6-16-17(12-14)30-20(24-16)25-19(27)23-15-4-2-3-13(11-15)18(26)29-10-9-28-8-7-21/h2-6,11-12H,7-10,21H2,(H2,23,24,25,27) |
| InChIKey | JSHMYORJQYRRMZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 119.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|