C19H17N5O2S — CID 156676809
1-(6-isocyano-1,3-benzothiazol-2-yl)-3-(3-morpholin-4-ylphenyl)urea (PubChem CID 156676809) has the molecular formula C19H17N5O2S and a molecular weight of 379.45 g/mol. Its IUPAC name is 1-(6-isocyano-1,3-benzothiazol-2-yl)-3-(3-morpholin-4-ylphenyl)urea.
| Compound Name | 1-(6-isocyano-1,3-benzothiazol-2-yl)-3-(3-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 156676809 |
| Molecular Formula | C19H17N5O2S |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-(6-isocyano-1,3-benzothiazol-2-yl)-3-(3-morpholin-4-ylphenyl)urea |
| SMILES | [C-]#[N+]c1ccc2nc(NC(=O)Nc3cccc(N4CCOCC4)c3)sc2c1 |
| InChI | InChI=1S/C19H17N5O2S/c1-20-13-5-6-16-17(12-13)27-19(22-16)23-18(25)21-14-3-2-4-15(11-14)24-7-9-26-10-8-24/h2-6,11-12H,7-10H2,(H2,21,22,23,25) |
| InChIKey | ZQZHTBBMLHLOLD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 70.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|