C14H18N4O2S2 — CID 87523128
1-(1-morpholin-4-ylethyl)-3-(6-sulfanyl-1,3-benzothiazol-2-yl)urea (PubChem CID 87523128) has the molecular formula C14H18N4O2S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(1-morpholin-4-ylethyl)-3-(6-sulfanyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(1-morpholin-4-ylethyl)-3-(6-sulfanyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 87523128 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(1-morpholin-4-ylethyl)-3-(6-sulfanyl-1,3-benzothiazol-2-yl)urea |
| SMILES | CC(NC(=O)Nc1nc2ccc(S)cc2s1)N1CCOCC1 |
| InChI | InChI=1S/C14H18N4O2S2/c1-9(18-4-6-20-7-5-18)15-13(19)17-14-16-11-3-2-10(21)8-12(11)22-14/h2-3,8-9,21H,4-7H2,1H3,(H2,15,16,17,19) |
| InChIKey | NKUJZWLJSQVZLC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|