C20H20N6OS — CID 153362558
1-[3-(4-cyanopiperazin-1-yl)phenyl]-3-(6-methyl-1,3-benzothiazol-2-yl)urea (PubChem CID 153362558) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is 1-[3-(4-cyanopiperazin-1-yl)phenyl]-3-(6-methyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[3-(4-cyanopiperazin-1-yl)phenyl]-3-(6-methyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 153362558 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 1-[3-(4-cyanopiperazin-1-yl)phenyl]-3-(6-methyl-1,3-benzothiazol-2-yl)urea |
| SMILES | Cc1ccc2nc(NC(=O)Nc3cccc(N4CCN(C#N)CC4)c3)sc2c1 |
| InChI | InChI=1S/C20H20N6OS/c1-14-5-6-17-18(11-14)28-20(23-17)24-19(27)22-15-3-2-4-16(12-15)26-9-7-25(13-21)8-10-26/h2-6,11-12H,7-10H2,1H3,(H2,22,23,24,27) |
| InChIKey | MTBLEJSZTAZYJA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|