C19H18N4O4S — CID 46385294
methyl 3-[[2-(propanoylamino)-1,3-benzothiazol-5-yl]carbamoylamino]benzoate (PubChem CID 46385294) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is methyl 3-[[2-(propanoylamino)-1,3-benzothiazol-5-yl]carbamoylamino]benzoate.
| Compound Name | methyl 3-[[2-(propanoylamino)-1,3-benzothiazol-5-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46385294 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | methyl 3-[[2-(propanoylamino)-1,3-benzothiazol-5-yl]carbamoylamino]benzoate |
| SMILES | CCC(=O)Nc1nc2cc(NC(=O)Nc3cccc(C(=O)OC)c3)ccc2s1 |
| InChI | InChI=1S/C19H18N4O4S/c1-3-16(24)23-19-22-14-10-13(7-8-15(14)28-19)21-18(26)20-12-6-4-5-11(9-12)17(25)27-2/h4-10H,3H2,1-2H3,(H2,20,21,26)(H,22,23,24) |
| InChIKey | UACQPDVJGKLJEJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |