C12H8ClN3OS — CID 89325859
6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine (PubChem CID 89325859) has the molecular formula C12H8ClN3OS and a molecular weight of 277.74 g/mol. Its IUPAC name is 6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine.
| Compound Name | 6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 89325859 |
| Molecular Formula | C12H8ClN3OS |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(Oc3ccnc(Cl)c3)cc2s1 |
| InChI | InChI=1S/C12H8ClN3OS/c13-11-6-8(3-4-15-11)17-7-1-2-9-10(5-7)18-12(14)16-9/h1-6H,(H2,14,16) |
| InChIKey | KKQOOJFVAPPFRD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|