C18H20ClN3O2S — CID 87421429
2-[[6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-yl]amino]-4-methylpentan-1-ol (PubChem CID 87421429) has the molecular formula C18H20ClN3O2S and a molecular weight of 377.90 g/mol. Its IUPAC name is 2-[[6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-yl]amino]-4-methylpentan-1-ol.
| Compound Name | 2-[[6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-yl]amino]-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 87421429 |
| Molecular Formula | C18H20ClN3O2S |
| Molecular Weight | 377.90 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[[6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-yl]amino]-4-methylpentan-1-ol |
| SMILES | CC(C)CC(CO)Nc1nc2ccc(Oc3ccnc(Cl)c3)cc2s1 |
| InChI | InChI=1S/C18H20ClN3O2S/c1-11(2)7-12(10-23)21-18-22-15-4-3-13(8-16(15)25-18)24-14-5-6-20-17(19)9-14/h3-6,8-9,11-12,23H,7,10H2,1-2H3,(H,21,22) |
| InChIKey | VHYKCGJJOMBSEG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.90 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|