C16H12ClN3O4S — CID 23859848
[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-chloropyridine-4-carboxylate (PubChem CID 23859848) has the molecular formula C16H12ClN3O4S and a molecular weight of 377.81 g/mol. Its IUPAC name is [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-chloropyridine-4-carboxylate.
| Compound Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-chloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 23859848 |
| Molecular Formula | C16H12ClN3O4S |
| Molecular Weight | 377.81 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-chloropyridine-4-carboxylate |
| SMILES | COc1ccc2nc(NC(=O)COC(=O)c3ccnc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C16H12ClN3O4S/c1-23-10-2-3-11-12(7-10)25-16(19-11)20-14(21)8-24-15(22)9-4-5-18-13(17)6-9/h2-7H,8H2,1H3,(H,19,20,21) |
| InChIKey | USSZBUHBCLZTKY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.81 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|