C18H13Cl3N2O5S — CID 23940659
[2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 23940659) has the molecular formula C18H13Cl3N2O5S and a molecular weight of 475.74 g/mol. Its IUPAC name is [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 23940659 |
| Molecular Formula | C18H13Cl3N2O5S |
| Molecular Weight | 475.74 g/mol |
| Exact Mass | 473.96 |
| IUPAC Name | [2-[(6-methoxy-1,3-benzothiazol-2-yl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | COc1ccc2nc(NC(=O)COC(=O)COc3cc(Cl)c(Cl)cc3Cl)sc2c1 |
| InChI | InChI=1S/C18H13Cl3N2O5S/c1-26-9-2-3-13-15(4-9)29-18(22-13)23-16(24)7-28-17(25)8-27-14-6-11(20)10(19)5-12(14)21/h2-6H,7-8H2,1H3,(H,22,23,24) |
| InChIKey | DSHGDPOCKDHKBN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.74 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|