C18H22ClN3O2S — CID 143564368
6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine;4-methylpentan-1-ol (PubChem CID 143564368) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is 6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine;4-methylpentan-1-ol.
| Compound Name | 6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine;4-methylpentan-1-ol |
|---|---|
| PubChem CID | 143564368 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 6-[(2-chloro-4-pyridinyl)oxy]-1,3-benzothiazol-2-amine;4-methylpentan-1-ol |
| SMILES | CC(C)CCCO.Nc1nc2ccc(Oc3ccnc(Cl)c3)cc2s1 |
| InChI | InChI=1S/C12H8ClN3OS.C6H14O/c13-11-6-8(3-4-15-11)17-7-1-2-9-10(5-7)18-12(14)16-9;1-6(2)4-3-5-7/h1-6H,(H2,14,16);6-7H,3-5H2,1-2H3 |
| InChIKey | BCKFOTSYAUGELR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|