C8H8FN3OS — CID 87338006
[6-(fluoromethoxy)-1,3-benzothiazol-2-yl]hydrazine (PubChem CID 87338006) has the molecular formula C8H8FN3OS and a molecular weight of 213.24 g/mol. Its IUPAC name is [6-(fluoromethoxy)-1,3-benzothiazol-2-yl]hydrazine.
| Compound Name | [6-(fluoromethoxy)-1,3-benzothiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 87338006 |
| Molecular Formula | C8H8FN3OS |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | [6-(fluoromethoxy)-1,3-benzothiazol-2-yl]hydrazine |
| SMILES | NNc1nc2ccc(OCF)cc2s1 |
| InChI | InChI=1S/C8H8FN3OS/c9-4-13-5-1-2-6-7(3-5)14-8(11-6)12-10/h1-3H,4,10H2,(H,11,12) |
| InChIKey | NIGUBGDEHNYKTR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|