C8H8N6S2 — CID 50882373
(2-hydrazinyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-6-yl)hydrazine (PubChem CID 50882373) has the molecular formula C8H8N6S2 and a molecular weight of 252.33 g/mol. Its IUPAC name is (2-hydrazinyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-6-yl)hydrazine.
| Compound Name | (2-hydrazinyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-6-yl)hydrazine |
|---|---|
| PubChem CID | 50882373 |
| Molecular Formula | C8H8N6S2 |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | (2-hydrazinyl-[1,3]thiazolo[4,5-f][1,3]benzothiazol-6-yl)hydrazine |
| SMILES | NNc1nc2cc3nc(NN)sc3cc2s1 |
| InChI | InChI=1S/C8H8N6S2/c9-13-7-11-3-1-4-6(2-5(3)15-7)16-8(12-4)14-10/h1-2H,9-10H2,(H,11,13)(H,12,14) |
| InChIKey | DKFAERWGWYCFOF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|