C9H8F3N3S — CID 86583251
[6-(2,2,2-trifluoroethyl)-1,3-benzothiazol-2-yl]hydrazine (PubChem CID 86583251) has the molecular formula C9H8F3N3S and a molecular weight of 247.24 g/mol. Its IUPAC name is [6-(2,2,2-trifluoroethyl)-1,3-benzothiazol-2-yl]hydrazine.
| Compound Name | [6-(2,2,2-trifluoroethyl)-1,3-benzothiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 86583251 |
| Molecular Formula | C9H8F3N3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | [6-(2,2,2-trifluoroethyl)-1,3-benzothiazol-2-yl]hydrazine |
| SMILES | NNc1nc2ccc(CC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C9H8F3N3S/c10-9(11,12)4-5-1-2-6-7(3-5)16-8(14-6)15-13/h1-3H,4,13H2,(H,14,15) |
| InChIKey | HPTNSXJGHZNBKL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|