C7H5N5S2 — CID 118201080
[1,3]thiazolo[4,5-f][2,1,3]benzothiadiazol-6-ylhydrazine (PubChem CID 118201080) has the molecular formula C7H5N5S2 and a molecular weight of 223.29 g/mol. Its IUPAC name is [1,3]thiazolo[4,5-f][2,1,3]benzothiadiazol-6-ylhydrazine.
| Compound Name | [1,3]thiazolo[4,5-f][2,1,3]benzothiadiazol-6-ylhydrazine |
|---|---|
| PubChem CID | 118201080 |
| Molecular Formula | C7H5N5S2 |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | [1,3]thiazolo[4,5-f][2,1,3]benzothiadiazol-6-ylhydrazine |
| SMILES | NNc1nc2cc3nsnc3cc2s1 |
| InChI | InChI=1S/C7H5N5S2/c8-10-7-9-5-1-3-4(12-14-11-3)2-6(5)13-7/h1-2H,8H2,(H,9,10) |
| InChIKey | LURVMNKVVFRPAC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|