C13H8ClN5S2 — CID 65473675
2-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-1,3-benzothiazole-2,6-diamine (PubChem CID 65473675) has the molecular formula C13H8ClN5S2 and a molecular weight of 333.83 g/mol. Its IUPAC name is 2-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 65473675 |
| Molecular Formula | C13H8ClN5S2 |
| Molecular Weight | 333.83 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 2-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-1,3-benzothiazole-2,6-diamine |
| SMILES | Nc1ccc2nc(Nc3c(Cl)ccc4nsnc34)sc2c1 |
| InChI | InChI=1S/C13H8ClN5S2/c14-7-2-4-9-12(19-21-18-9)11(7)17-13-16-8-3-1-6(15)5-10(8)20-13/h1-5H,15H2,(H,16,17) |
| InChIKey | YLHGZISVACXPLW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|