C12H8ClN5S2 — CID 65473602
2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide (PubChem CID 65473602) has the molecular formula C12H8ClN5S2 and a molecular weight of 321.82 g/mol. Its IUPAC name is 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide.
| Compound Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide |
|---|---|
| PubChem CID | 65473602 |
| Molecular Formula | C12H8ClN5S2 |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Nc2c(Cl)ccc3nsnc23)c1 |
| InChI | InChI=1S/C12H8ClN5S2/c13-7-1-2-8-11(18-20-17-8)10(7)16-9-5-6(12(14)19)3-4-15-9/h1-5H,(H2,14,19)(H,15,16) |
| InChIKey | BPNZMGJJOYIDTO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|