About 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide
2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide (PubChem CID 65473602) has the molecular formula C12H8ClN5S2
and a molecular weight of 321.82 g/mol. Its IUPAC name is 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide.
Molecular Properties
| Compound Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide |
| PubChem CID | 65473602 |
| Molecular Formula | C12H8ClN5S2 |
| Molecular Weight | 321.82 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide |
| SMILES | NC(=S)c1ccnc(Nc2c(Cl)ccc3nsnc23)c1 |
| InChI | InChI=1S/C12H8ClN5S2/c13-7-1-2-8-11(18-20-17-8)10(7)16-9-5-6(12(14)19)3-4-15-9/h1-5H,(H2,14,19)(H,15,16) |
| InChIKey | BPNZMGJJOYIDTO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.82 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide?
The IUPAC name of 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide (CID 65473602) is 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide.
What is the SMILES notation for 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide?
The canonical SMILES for 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide is NC(=S)c1ccnc(Nc2c(Cl)ccc3nsnc23)c1.
What is the InChIKey of 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide?
The InChIKey is BPNZMGJJOYIDTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClN5S2/c13-7-1-2-8-11(18-20-17-8)10(7)16-9-5-6(12(14)19)3-4-15-9/h1-5H,(H2,14,19)(H,15,16).
What are the key properties of 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide?
2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide has a molecular weight of 321.82 g/mol, XLogP of 3.12, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]pyridine-4-carbothioamide is sourced from PubChem (CID 65473602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).