C14H11ClN4S2 — CID 107929062
2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]-5-methylbenzenecarbothioamide (PubChem CID 107929062) has the molecular formula C14H11ClN4S2 and a molecular weight of 334.86 g/mol. Its IUPAC name is 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]-5-methylbenzenecarbothioamide.
| Compound Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]-5-methylbenzenecarbothioamide |
|---|---|
| PubChem CID | 107929062 |
| Molecular Formula | C14H11ClN4S2 |
| Molecular Weight | 334.86 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-[(5-chloro-2,1,3-benzothiadiazol-4-yl)amino]-5-methylbenzenecarbothioamide |
| SMILES | Cc1ccc(Nc2c(Cl)ccc3nsnc23)c(C(N)=S)c1 |
| InChI | InChI=1S/C14H11ClN4S2/c1-7-2-4-10(8(6-7)14(16)20)17-12-9(15)3-5-11-13(12)19-21-18-11/h2-6,17H,1H3,(H2,16,20) |
| InChIKey | UGSXMSVIXGVDCU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.86 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|