C15H20N2O2S — CID 82548458
ethyl 3-[2-(propylamino)-1,3-benzothiazol-6-yl]propanoate (PubChem CID 82548458) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is ethyl 3-[2-(propylamino)-1,3-benzothiazol-6-yl]propanoate.
| Compound Name | ethyl 3-[2-(propylamino)-1,3-benzothiazol-6-yl]propanoate |
|---|---|
| PubChem CID | 82548458 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | ethyl 3-[2-(propylamino)-1,3-benzothiazol-6-yl]propanoate |
| SMILES | CCCNc1nc2ccc(CCC(=O)OCC)cc2s1 |
| InChI | InChI=1S/C15H20N2O2S/c1-3-9-16-15-17-12-7-5-11(10-13(12)20-15)6-8-14(18)19-4-2/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,16,17) |
| InChIKey | ZIJTUKIYLFVXDP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |