C18H19N3O2S — CID 174464415
ethyl 2-[2-[2-(aminomethyl)anilino]-1,3-benzothiazol-6-yl]acetate (PubChem CID 174464415) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is ethyl 2-[2-[2-(aminomethyl)anilino]-1,3-benzothiazol-6-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(aminomethyl)anilino]-1,3-benzothiazol-6-yl]acetate |
|---|---|
| PubChem CID | 174464415 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | ethyl 2-[2-[2-(aminomethyl)anilino]-1,3-benzothiazol-6-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc2nc(Nc3ccccc3CN)sc2c1 |
| InChI | InChI=1S/C18H19N3O2S/c1-2-23-17(22)10-12-7-8-15-16(9-12)24-18(21-15)20-14-6-4-3-5-13(14)11-19/h3-9H,2,10-11,19H2,1H3,(H,20,21) |
| InChIKey | FMXUIVAWPYYYHL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |