C15H14N4OS — CID 115544304
2-amino-3-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzamide (PubChem CID 115544304) has the molecular formula C15H14N4OS and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-amino-3-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzamide.
| Compound Name | 2-amino-3-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 115544304 |
| Molecular Formula | C15H14N4OS |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2-amino-3-[(6-methyl-1,3-benzothiazol-2-yl)amino]benzamide |
| SMILES | Cc1ccc2nc(Nc3cccc(C(N)=O)c3N)sc2c1 |
| InChI | InChI=1S/C15H14N4OS/c1-8-5-6-10-12(7-8)21-15(18-10)19-11-4-2-3-9(13(11)16)14(17)20/h2-7H,16H2,1H3,(H2,17,20)(H,18,19) |
| InChIKey | HOPXXHDFMBLNQN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|