C9H9N3OS — CID 86767320
(NE)-N-[1-(2-amino-1,3-benzothiazol-6-yl)ethylidene]hydroxylamine (PubChem CID 86767320) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is (NE)-N-[1-(2-amino-1,3-benzothiazol-6-yl)ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-(2-amino-1,3-benzothiazol-6-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 86767320 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | (NE)-N-[1-(2-amino-1,3-benzothiazol-6-yl)ethylidene]hydroxylamine |
| SMILES | C/C(=N\O)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C9H9N3OS/c1-5(12-13)6-2-3-7-8(4-6)14-9(10)11-7/h2-4,13H,1H3,(H2,10,11)/b12-5+ |
| InChIKey | ZQTZTDPTMOJPDU-LFYBBSHMSA-N |
| XLogP | 2.08 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|