C16H17ClN4OS — CID 118713163
4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-2-yl]aniline;hydrate;hydrochloride (PubChem CID 118713163) has the molecular formula C16H17ClN4OS and a molecular weight of 348.86 g/mol. Its IUPAC name is 4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-2-yl]aniline;hydrate;hydrochloride.
| Compound Name | 4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-2-yl]aniline;hydrate;hydrochloride |
|---|---|
| PubChem CID | 118713163 |
| Molecular Formula | C16H17ClN4OS |
| Molecular Weight | 348.86 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 4-[6-(4,5-dihydro-1H-imidazol-2-yl)-1,3-benzothiazol-2-yl]aniline;hydrate;hydrochloride |
| SMILES | Cl.Nc1ccc(-c2nc3ccc(C4=NCCN4)cc3s2)cc1.O |
| InChI | InChI=1S/C16H14N4S.ClH.H2O/c17-12-4-1-10(2-5-12)16-20-13-6-3-11(9-14(13)21-16)15-18-7-8-19-15;;/h1-6,9H,7-8,17H2,(H,18,19);1H;1H2 |
| InChIKey | DDXQVVURVRAPLP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.86 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|