C13H9BrN2OS — CID 60837711
2-amino-5-(5-bromo-1,3-benzothiazol-2-yl)phenol (PubChem CID 60837711) has the molecular formula C13H9BrN2OS and a molecular weight of 321.20 g/mol. Its IUPAC name is 2-amino-5-(5-bromo-1,3-benzothiazol-2-yl)phenol.
| Compound Name | 2-amino-5-(5-bromo-1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 60837711 |
| Molecular Formula | C13H9BrN2OS |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 319.96 |
| IUPAC Name | 2-amino-5-(5-bromo-1,3-benzothiazol-2-yl)phenol |
| SMILES | Nc1ccc(-c2nc3cc(Br)ccc3s2)cc1O |
| InChI | InChI=1S/C13H9BrN2OS/c14-8-2-4-12-10(6-8)16-13(18-12)7-1-3-9(15)11(17)5-7/h1-6,17H,15H2 |
| InChIKey | WNWMBMAAUBZIRJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|