About 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine
2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine (PubChem CID 107495956) has the molecular formula C12H11BrN4S
and a molecular weight of 323.22 g/mol. Its IUPAC name is 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine |
| PubChem CID | 107495956 |
| Molecular Formula | C12H11BrN4S |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine |
| SMILES | NCCn1cnc(-c2nc3cc(Br)ccc3s2)c1 |
| InChI | InChI=1S/C12H11BrN4S/c13-8-1-2-11-9(5-8)16-12(18-11)10-6-17(4-3-14)7-15-10/h1-2,5-7H,3-4,14H2 |
| InChIKey | HOKFTPJCHKWGFG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine?
The IUPAC name of 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine (CID 107495956) is 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine.
What is the SMILES notation for 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine?
The canonical SMILES for 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine is NCCn1cnc(-c2nc3cc(Br)ccc3s2)c1.
What is the InChIKey of 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine?
The InChIKey is HOKFTPJCHKWGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN4S/c13-8-1-2-11-9(5-8)16-12(18-11)10-6-17(4-3-14)7-15-10/h1-2,5-7H,3-4,14H2.
What are the key properties of 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine?
2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine has a molecular weight of 323.22 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-bromo-1,3-benzothiazol-2-yl)imidazol-1-yl]ethanamine is sourced from PubChem (CID 107495956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).