C17H11NO3S — CID 135708267
3-hydroxy-2-(6-methoxy-1,3-benzothiazol-2-yl)inden-1-one (PubChem CID 135708267) has the molecular formula C17H11NO3S and a molecular weight of 309.35 g/mol. Its IUPAC name is 3-hydroxy-2-(6-methoxy-1,3-benzothiazol-2-yl)inden-1-one.
| Compound Name | 3-hydroxy-2-(6-methoxy-1,3-benzothiazol-2-yl)inden-1-one |
|---|---|
| PubChem CID | 135708267 |
| Molecular Formula | C17H11NO3S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 3-hydroxy-2-(6-methoxy-1,3-benzothiazol-2-yl)inden-1-one |
| SMILES | COc1ccc2nc(C3=C(O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C17H11NO3S/c1-21-9-6-7-12-13(8-9)22-17(18-12)14-15(19)10-4-2-3-5-11(10)16(14)20/h2-8,19H,1H3 |
| InChIKey | OMRVKSZQFLKAOP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|