C14H12BNO3S — CID 122368528
[2-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]boronic acid (PubChem CID 122368528) has the molecular formula C14H12BNO3S and a molecular weight of 285.13 g/mol. Its IUPAC name is [2-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]boronic acid.
| Compound Name | [2-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]boronic acid |
|---|---|
| PubChem CID | 122368528 |
| Molecular Formula | C14H12BNO3S |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [2-(1,3-benzothiazol-2-yl)-4-methoxyphenyl]boronic acid |
| SMILES | COc1ccc(B(O)O)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C14H12BNO3S/c1-19-9-6-7-11(15(17)18)10(8-9)14-16-12-4-2-3-5-13(12)20-14/h2-8,17-18H,1H3 |
| InChIKey | PAHVCYYDDNLHKM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|