C26H21NO7 — CID 1409433
2-(4-methoxyphenyl)-6,8-dimethyl-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one (PubChem CID 1409433) has the molecular formula C26H21NO7 and a molecular weight of 459.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-6,8-dimethyl-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one.
| Compound Name | 2-(4-methoxyphenyl)-6,8-dimethyl-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one |
|---|---|
| PubChem CID | 1409433 |
| Molecular Formula | C26H21NO7 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 2-(4-methoxyphenyl)-6,8-dimethyl-3-[2-(3-nitrophenyl)-2-oxoethoxy]chromen-4-one |
| SMILES | COc1ccc(-c2oc3c(C)cc(C)cc3c(=O)c2OCC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C26H21NO7/c1-15-11-16(2)24-21(12-15)23(29)26(25(34-24)17-7-9-20(32-3)10-8-17)33-14-22(28)18-5-4-6-19(13-18)27(30)31/h4-13H,14H2,1-3H3 |
| InChIKey | DLZSTWWFFSCIAB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 108.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|