C20H17NO10 — CID 142727079
(4S)-4-amino-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-oxopentanoic acid (PubChem CID 142727079) has the molecular formula C20H17NO10 and a molecular weight of 431.35 g/mol. Its IUPAC name is (4S)-4-amino-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-oxopentanoic acid.
| Compound Name | (4S)-4-amino-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 142727079 |
| Molecular Formula | C20H17NO10 |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (4S)-4-amino-5-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxochromen-3-yl]oxy-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)O)C(=O)Oc1c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c2c1=O |
| InChI | InChI=1S/C20H17NO10/c21-10(2-4-15(26)27)20(29)31-19-17(28)16-13(25)6-9(22)7-14(16)30-18(19)8-1-3-11(23)12(24)5-8/h1,3,5-7,10,22-25H,2,4,21H2,(H,26,27)/t10-/m0/s1 |
| InChIKey | BKYDKKNHTLJIMM-JTQLQIEISA-N |
| XLogP | 1.38 |
| TPSA | 200.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|