C23H26N2O12 — CID 175338165
2-[(2S)-2,6-diaminohexanoyl]oxy-2-hydroxyacetic acid;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one (PubChem CID 175338165) has the molecular formula C23H26N2O12 and a molecular weight of 522.46 g/mol. Its IUPAC name is 2-[(2S)-2,6-diaminohexanoyl]oxy-2-hydroxyacetic acid;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-[(2S)-2,6-diaminohexanoyl]oxy-2-hydroxyacetic acid;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 175338165 |
| Molecular Formula | C23H26N2O12 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 2-[(2S)-2,6-diaminohexanoyl]oxy-2-hydroxyacetic acid;2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| SMILES | NCCCC[C@H](N)C(=O)OC(O)C(=O)O.O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7.C8H16N2O5/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6;9-4-2-1-3-5(10)7(13)15-8(14)6(11)12/h1-5,16-19,21H;5,8,14H,1-4,9-10H2,(H,11,12)/t;5-,8?/m.0/s1 |
| InChIKey | PHOUDPMHISBZMY-AQSBCVMVSA-N |
| XLogP | 0.38 |
| TPSA | 267.23 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|