C32H39NO5 — CID 164861388
2-[4-[5-(1-adamantylmethylamino)pentyl]phenyl]-5,7-dihydroxy-8-methoxychromen-4-one (PubChem CID 164861388) has the molecular formula C32H39NO5 and a molecular weight of 517.67 g/mol. Its IUPAC name is 2-[4-[5-(1-adamantylmethylamino)pentyl]phenyl]-5,7-dihydroxy-8-methoxychromen-4-one.
| Compound Name | 2-[4-[5-(1-adamantylmethylamino)pentyl]phenyl]-5,7-dihydroxy-8-methoxychromen-4-one |
|---|---|
| PubChem CID | 164861388 |
| Molecular Formula | C32H39NO5 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 2-[4-[5-(1-adamantylmethylamino)pentyl]phenyl]-5,7-dihydroxy-8-methoxychromen-4-one |
| SMILES | COc1c(O)cc(O)c2c(=O)cc(-c3ccc(CCCCCNCC45CC6CC(CC(C6)C4)C5)cc3)oc12 |
| InChI | InChI=1S/C32H39NO5/c1-37-30-27(36)14-25(34)29-26(35)15-28(38-31(29)30)24-8-6-20(7-9-24)5-3-2-4-10-33-19-32-16-21-11-22(17-32)13-23(12-21)18-32/h6-9,14-15,21-23,33-34,36H,2-5,10-13,16-19H2,1H3 |
| InChIKey | OKQBWFGJXOPWJV-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|