C27H26O7 — CID 162965681
7-hydroxy-2-(4-hydroxyphenyl)-5-(3-hydroxypropoxy)-6-methoxy-8-(2-phenylethyl)chromen-4-one (PubChem CID 162965681) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is 7-hydroxy-2-(4-hydroxyphenyl)-5-(3-hydroxypropoxy)-6-methoxy-8-(2-phenylethyl)chromen-4-one.
| Compound Name | 7-hydroxy-2-(4-hydroxyphenyl)-5-(3-hydroxypropoxy)-6-methoxy-8-(2-phenylethyl)chromen-4-one |
|---|---|
| PubChem CID | 162965681 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 7-hydroxy-2-(4-hydroxyphenyl)-5-(3-hydroxypropoxy)-6-methoxy-8-(2-phenylethyl)chromen-4-one |
| SMILES | COc1c(O)c(CCc2ccccc2)c2oc(-c3ccc(O)cc3)cc(=O)c2c1OCCCO |
| InChI | InChI=1S/C27H26O7/c1-32-27-24(31)20(13-8-17-6-3-2-4-7-17)25-23(26(27)33-15-5-14-28)21(30)16-22(34-25)18-9-11-19(29)12-10-18/h2-4,6-7,9-12,16,28-29,31H,5,8,13-15H2,1H3 |
| InChIKey | QMMJZVQSVMIGBL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|