C29H24N4O — CID 156672530
2-[6-(4-ethylphenyl)-5-isocyano-3-methyl-1-(3-methylphenyl)pyrazolo[3,4-b]pyridin-4-yl]phenol (PubChem CID 156672530) has the molecular formula C29H24N4O and a molecular weight of 444.54 g/mol. Its IUPAC name is 2-[6-(4-ethylphenyl)-5-isocyano-3-methyl-1-(3-methylphenyl)pyrazolo[3,4-b]pyridin-4-yl]phenol.
| Compound Name | 2-[6-(4-ethylphenyl)-5-isocyano-3-methyl-1-(3-methylphenyl)pyrazolo[3,4-b]pyridin-4-yl]phenol |
|---|---|
| PubChem CID | 156672530 |
| Molecular Formula | C29H24N4O |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[6-(4-ethylphenyl)-5-isocyano-3-methyl-1-(3-methylphenyl)pyrazolo[3,4-b]pyridin-4-yl]phenol |
| SMILES | [C-]#[N+]c1c(-c2ccc(CC)cc2)nc2c(c(C)nn2-c2cccc(C)c2)c1-c1ccccc1O |
| InChI | InChI=1S/C29H24N4O/c1-5-20-13-15-21(16-14-20)27-28(30-4)26(23-11-6-7-12-24(23)34)25-19(3)32-33(29(25)31-27)22-10-8-9-18(2)17-22/h6-17,34H,5H2,1-3H3 |
| InChIKey | VINKUWFGARORHR-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 55.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|