C12H8ClN5 — CID 30032592
2-(5-chloro-3-phenyl-1,2,4-triazol-1-yl)pyrimidine (PubChem CID 30032592) has the molecular formula C12H8ClN5 and a molecular weight of 257.68 g/mol. Its IUPAC name is 2-(5-chloro-3-phenyl-1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 2-(5-chloro-3-phenyl-1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 30032592 |
| Molecular Formula | C12H8ClN5 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(5-chloro-3-phenyl-1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Clc1nc(-c2ccccc2)nn1-c1ncccn1 |
| InChI | InChI=1S/C12H8ClN5/c13-11-16-10(9-5-2-1-3-6-9)17-18(11)12-14-7-4-8-15-12/h1-8H |
| InChIKey | UPSONTHXJIMZLH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |