C27H19N3 — CID 58037472
1-(9H-fluoren-3-yl)-3,5-diphenyl-1,2,4-triazole (PubChem CID 58037472) has the molecular formula C27H19N3 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-(9H-fluoren-3-yl)-3,5-diphenyl-1,2,4-triazole.
| Compound Name | 1-(9H-fluoren-3-yl)-3,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58037472 |
| Molecular Formula | C27H19N3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1-(9H-fluoren-3-yl)-3,5-diphenyl-1,2,4-triazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)n(-c3ccc4c(c3)-c3ccccc3C4)n2)cc1 |
| InChI | InChI=1S/C27H19N3/c1-3-9-19(10-4-1)26-28-27(20-11-5-2-6-12-20)30(29-26)23-16-15-22-17-21-13-7-8-14-24(21)25(22)18-23/h1-16,18H,17H2 |
| InChIKey | LRJLKTJKOANFQS-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |