C20H15N3 — CID 563249
1,3,5-triphenyl-1,2,4-triazole (PubChem CID 563249) has the molecular formula C20H15N3 and a molecular weight of 297.36 g/mol. Its IUPAC name is 1,3,5-triphenyl-1,2,4-triazole.
| Compound Name | 1,3,5-triphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 563249 |
| Molecular Formula | C20H15N3 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1,3,5-triphenyl-1,2,4-triazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H15N3/c1-4-10-16(11-5-1)19-21-20(17-12-6-2-7-13-17)23(22-19)18-14-8-3-9-15-18/h1-15H |
| InChIKey | ZUADNMDNEIWVSE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |