C22H13N5 — CID 618453
4-(3,5-diphenyl-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile (PubChem CID 618453) has the molecular formula C22H13N5 and a molecular weight of 347.38 g/mol. Its IUPAC name is 4-(3,5-diphenyl-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile.
| Compound Name | 4-(3,5-diphenyl-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 618453 |
| Molecular Formula | C22H13N5 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-(3,5-diphenyl-1,2,4-triazol-4-yl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(-n2c(-c3ccccc3)nnc2-c2ccccc2)cc1C#N |
| InChI | InChI=1S/C22H13N5/c23-14-18-11-12-20(13-19(18)15-24)27-21(16-7-3-1-4-8-16)25-26-22(27)17-9-5-2-6-10-17/h1-13H |
| InChIKey | SXYLUHXVLAHSNH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |