C44H36N4S — CID 146534121
3,5-bis(9,9-dimethyl-10-phenylacridin-3-yl)-1,2,4-thiadiazole (PubChem CID 146534121) has the molecular formula C44H36N4S and a molecular weight of 652.87 g/mol. Its IUPAC name is 3,5-bis(9,9-dimethyl-10-phenylacridin-3-yl)-1,2,4-thiadiazole.
| Compound Name | 3,5-bis(9,9-dimethyl-10-phenylacridin-3-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 146534121 |
| Molecular Formula | C44H36N4S |
| Molecular Weight | 652.87 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 3,5-bis(9,9-dimethyl-10-phenylacridin-3-yl)-1,2,4-thiadiazole |
| SMILES | CC1(C)c2ccccc2N(c2ccccc2)c2cc(-c3nsc(-c4ccc5c(c4)N(c4ccccc4)c4ccccc4C5(C)C)n3)ccc21 |
| InChI | InChI=1S/C44H36N4S/c1-43(2)33-19-11-13-21-37(33)47(31-15-7-5-8-16-31)39-27-29(23-25-35(39)43)41-45-42(49-46-41)30-24-26-36-40(28-30)48(32-17-9-6-10-18-32)38-22-14-12-20-34(38)44(36,3)4/h5-28H,1-4H3 |
| InChIKey | JDSGSFZQVDHDMC-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.87 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |