C27H24O — CID 71579983
2-[5-(4-tert-butylphenyl)naphthalen-2-yl]benzaldehyde (PubChem CID 71579983) has the molecular formula C27H24O and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[5-(4-tert-butylphenyl)naphthalen-2-yl]benzaldehyde.
| Compound Name | 2-[5-(4-tert-butylphenyl)naphthalen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 71579983 |
| Molecular Formula | C27H24O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[5-(4-tert-butylphenyl)naphthalen-2-yl]benzaldehyde |
| SMILES | CC(C)(C)c1ccc(-c2cccc3cc(-c4ccccc4C=O)ccc23)cc1 |
| InChI | InChI=1S/C27H24O/c1-27(2,3)23-14-11-19(12-15-23)25-10-6-8-20-17-21(13-16-26(20)25)24-9-5-4-7-22(24)18-28/h4-18H,1-3H3 |
| InChIKey | GNPYIIOTIJLCRR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|