C29H32IN — CID 71579798
[4-[5-(4-tert-butylphenyl)naphthalen-2-yl]phenyl]-trimethylazanium iodide (PubChem CID 71579798) has the molecular formula C29H32IN and a molecular weight of 521.49 g/mol. Its IUPAC name is [4-[5-(4-tert-butylphenyl)naphthalen-2-yl]phenyl]-trimethylazanium iodide.
| Compound Name | [4-[5-(4-tert-butylphenyl)naphthalen-2-yl]phenyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 71579798 |
| Molecular Formula | C29H32IN |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | [4-[5-(4-tert-butylphenyl)naphthalen-2-yl]phenyl]-trimethylazanium iodide |
| SMILES | CC(C)(C)c1ccc(-c2cccc3cc(-c4ccc([N+](C)(C)C)cc4)ccc23)cc1.[I-] |
| InChI | InChI=1S/C29H32N.HI/c1-29(2,3)25-15-10-22(11-16-25)27-9-7-8-24-20-23(14-19-28(24)27)21-12-17-26(18-13-21)30(4,5)6;/h7-20H,1-6H3;1H/q+1;/p-1 |
| InChIKey | CZGALOXOMSLPPV-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|