C32H30IN — CID 71579893
trimethyl-[[3-[5-(3-phenylphenyl)naphthalen-2-yl]phenyl]methyl]azanium iodide (PubChem CID 71579893) has the molecular formula C32H30IN and a molecular weight of 555.50 g/mol. Its IUPAC name is trimethyl-[[3-[5-(3-phenylphenyl)naphthalen-2-yl]phenyl]methyl]azanium iodide.
| Compound Name | trimethyl-[[3-[5-(3-phenylphenyl)naphthalen-2-yl]phenyl]methyl]azanium iodide |
|---|---|
| PubChem CID | 71579893 |
| Molecular Formula | C32H30IN |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | trimethyl-[[3-[5-(3-phenylphenyl)naphthalen-2-yl]phenyl]methyl]azanium iodide |
| SMILES | C[N+](C)(C)Cc1cccc(-c2ccc3c(-c4cccc(-c5ccccc5)c4)cccc3c2)c1.[I-] |
| InChI | InChI=1S/C32H30N.HI/c1-33(2,3)23-24-10-7-13-26(20-24)28-18-19-32-30(22-28)16-9-17-31(32)29-15-8-14-27(21-29)25-11-5-4-6-12-25;/h4-22H,23H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GPDISMFXQGKXSX-UHFFFAOYSA-M |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|