C31H32O2 — CID 118296817
4-[5-(4-tert-butylphenyl)naphthalen-2-yl]-3-(2-methylpropyl)benzoic acid (PubChem CID 118296817) has the molecular formula C31H32O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[5-(4-tert-butylphenyl)naphthalen-2-yl]-3-(2-methylpropyl)benzoic acid.
| Compound Name | 4-[5-(4-tert-butylphenyl)naphthalen-2-yl]-3-(2-methylpropyl)benzoic acid |
|---|---|
| PubChem CID | 118296817 |
| Molecular Formula | C31H32O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 4-[5-(4-tert-butylphenyl)naphthalen-2-yl]-3-(2-methylpropyl)benzoic acid |
| SMILES | CC(C)Cc1cc(C(=O)O)ccc1-c1ccc2c(-c3ccc(C(C)(C)C)cc3)cccc2c1 |
| InChI | InChI=1S/C31H32O2/c1-20(2)17-25-19-24(30(32)33)12-15-27(25)23-11-16-29-22(18-23)7-6-8-28(29)21-9-13-26(14-10-21)31(3,4)5/h6-16,18-20H,17H2,1-5H3,(H,32,33) |
| InChIKey | CQHFMYZUVZKKMY-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |