C48H50O4 — CID 164911922
2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(phenylmethoxy)butyl]-6-(2,4,6-trimethylphenyl)phenol (PubChem CID 164911922) has the molecular formula C48H50O4 and a molecular weight of 690.92 g/mol. Its IUPAC name is 2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(phenylmethoxy)butyl]-6-(2,4,6-trimethylphenyl)phenol.
| Compound Name | 2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(phenylmethoxy)butyl]-6-(2,4,6-trimethylphenyl)phenol |
|---|---|
| PubChem CID | 164911922 |
| Molecular Formula | C48H50O4 |
| Molecular Weight | 690.92 g/mol |
| Exact Mass | 690.37 |
| IUPAC Name | 2-[(2R,3R)-4-[2-hydroxy-3-(2,4,6-trimethylphenyl)phenyl]-2,3-bis(phenylmethoxy)butyl]-6-(2,4,6-trimethylphenyl)phenol |
| SMILES | Cc1cc(C)c(-c2cccc(C[C@@H](OCc3ccccc3)[C@@H](Cc3cccc(-c4c(C)cc(C)cc4C)c3O)OCc3ccccc3)c2O)c(C)c1 |
| InChI | InChI=1S/C48H50O4/c1-31-23-33(3)45(34(4)24-31)41-21-13-19-39(47(41)49)27-43(51-29-37-15-9-7-10-16-37)44(52-30-38-17-11-8-12-18-38)28-40-20-14-22-42(48(40)50)46-35(5)25-32(2)26-36(46)6/h7-26,43-44,49-50H,27-30H2,1-6H3/t43-,44-/m1/s1 |
| InChIKey | PVFULAZYJOSOBM-NDOUMJCMSA-N |
| XLogP | 11.24 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.92 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |