C17H18O4 — CID 117461801
3-(2-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoic acid (PubChem CID 117461801) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is 3-(2-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(2-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 117461801 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-(2-hydroxy-3-phenylmethoxyphenyl)-2-methylpropanoic acid |
| SMILES | CC(Cc1cccc(OCc2ccccc2)c1O)C(=O)O |
| InChI | InChI=1S/C17H18O4/c1-12(17(19)20)10-14-8-5-9-15(16(14)18)21-11-13-6-3-2-4-7-13/h2-9,12,18H,10-11H2,1H3,(H,19,20) |
| InChIKey | JDBGAOBENCWSMU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |