C28H34N2O3 — CID 57111343
(2S)-2-amino-N-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-4-phenylbutanamide (PubChem CID 57111343) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is (2S)-2-amino-N-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-4-phenylbutanamide.
| Compound Name | (2S)-2-amino-N-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-4-phenylbutanamide |
|---|---|
| PubChem CID | 57111343 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (2S)-2-amino-N-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-4-phenylbutanamide |
| SMILES | CCC(CCc1cccc(OCc2ccccc2)c1O)NC(=O)[C@@H](N)CCc1ccccc1 |
| InChI | InChI=1S/C28H34N2O3/c1-2-24(30-28(32)25(29)19-16-21-10-5-3-6-11-21)18-17-23-14-9-15-26(27(23)31)33-20-22-12-7-4-8-13-22/h3-15,24-25,31H,2,16-20,29H2,1H3,(H,30,32)/t24?,25-/m0/s1 |
| InChIKey | URBMUNSRHFNCRE-BBMPLOMVSA-N |
| XLogP | 4.76 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |