C26H30N2O4 — CID 57139589
1-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-3-(3-methoxyphenyl)urea (PubChem CID 57139589) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 57139589 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-[1-(2-hydroxy-3-phenylmethoxyphenyl)pentan-3-yl]-3-(3-methoxyphenyl)urea |
| SMILES | CCC(CCc1cccc(OCc2ccccc2)c1O)NC(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C26H30N2O4/c1-3-21(27-26(30)28-22-12-8-13-23(17-22)31-2)16-15-20-11-7-14-24(25(20)29)32-18-19-9-5-4-6-10-19/h4-14,17,21,29H,3,15-16,18H2,1-2H3,(H2,27,28,30) |
| InChIKey | JBHFFIANFNXALD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |