About ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one
ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one (PubChem CID 144636073) has the molecular formula C26H34O3
and a molecular weight of 394.56 g/mol. Its IUPAC name is ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one.
Molecular Properties
| Compound Name | ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
| PubChem CID | 144636073 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one |
| SMILES | CC.Cc1cc(C)c(C2=C(O)CC(C(C)OCc3ccccc3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C24H28O3.C2H6/c1-15-10-16(2)23(17(3)11-15)24-21(25)12-20(13-22(24)26)18(4)27-14-19-8-6-5-7-9-19;1-2/h5-11,18,20,25H,12-14H2,1-4H3;1-2H3 |
| InChIKey | ATPCXVRSOOBTRJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one?
The IUPAC name of ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one (CID 144636073) is ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one.
What is the SMILES notation for ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one?
The canonical SMILES for ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one is CC.Cc1cc(C)c(C2=C(O)CC(C(C)OCc3ccccc3)CC2=O)c(C)c1.
What is the InChIKey of ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one?
The InChIKey is ATPCXVRSOOBTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O3.C2H6/c1-15-10-16(2)23(17(3)11-15)24-21(25)12-20(13-22(24)26)18(4)27-14-19-8-6-5-7-9-19;1-2/h5-11,18,20,25H,12-14H2,1-4H3;1-2H3.
What are the key properties of ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one?
ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one has a molecular weight of 394.56 g/mol, XLogP of 6.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-hydroxy-5-(1-phenylmethoxyethyl)-2-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one is sourced from PubChem (CID 144636073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).